About [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine
[1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 106649488) has the molecular formula C10H18F2N2
and a molecular weight of 204.26 g/mol. Its IUPAC name is [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine.
Molecular Properties
| Compound Name | [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine |
| PubChem CID | 106649488 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(C1=CCCCCCC1)C(F)F |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)9(14-13)8-6-4-2-1-3-5-7-8/h6,9-10,14H,1-5,7,13H2 |
| InChIKey | QBZMOFHDZIKXIX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine?
The IUPAC name of [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine (CID 106649488) is [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine.
What is the SMILES notation for [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine?
The canonical SMILES for [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine is NNC(C1=CCCCCCC1)C(F)F.
What is the InChIKey of [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine?
The InChIKey is QBZMOFHDZIKXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2/c11-10(12)9(14-13)8-6-4-2-1-3-5-7-8/h6,9-10,14H,1-5,7,13H2.
What are the key properties of [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine?
[1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine has a molecular weight of 204.26 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cycloocten-1-yl)-2,2-difluoroethyl]hydrazine is sourced from PubChem (CID 106649488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).