C15H26F2N2 — CID 106650056
[cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine (PubChem CID 106650056) has the molecular formula C15H26F2N2 and a molecular weight of 272.38 g/mol. Its IUPAC name is [cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine.
| Compound Name | [cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106650056 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H26F2N2/c16-15(17)10-8-13(9-11-15)14(19-18)12-6-4-2-1-3-5-7-12/h6,13-14,19H,1-5,7-11,18H2 |
| InChIKey | FTQLPXKRSBBBTN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|