C18H23N3 — CID 106650256
[cyclohepten-1-yl-(2-methylquinolin-4-yl)methyl]hydrazine (PubChem CID 106650256) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is [cyclohepten-1-yl-(2-methylquinolin-4-yl)methyl]hydrazine.
| Compound Name | [cyclohepten-1-yl-(2-methylquinolin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106650256 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | [cyclohepten-1-yl-(2-methylquinolin-4-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2=CCCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H23N3/c1-13-12-16(15-10-6-7-11-17(15)20-13)18(21-19)14-8-4-2-3-5-9-14/h6-8,10-12,18,21H,2-5,9,19H2,1H3 |
| InChIKey | QHOUQZHZUXYSLL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|