About [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine
[1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine (PubChem CID 106650486) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine.
Molecular Properties
| Compound Name | [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine |
| PubChem CID | 106650486 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine |
| SMILES | CC(C)C(C)C(NN)C1=CCCCC1 |
| InChI | InChI=1S/C12H24N2/c1-9(2)10(3)12(14-13)11-7-5-4-6-8-11/h7,9-10,12,14H,4-6,8,13H2,1-3H3 |
| InChIKey | ZGDZGBVYQOMTRX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine?
The IUPAC name of [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine (CID 106650486) is [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine.
What is the SMILES notation for [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine?
The canonical SMILES for [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine is CC(C)C(C)C(NN)C1=CCCCC1.
What is the InChIKey of [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine?
The InChIKey is ZGDZGBVYQOMTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-9(2)10(3)12(14-13)11-7-5-4-6-8-11/h7,9-10,12,14H,4-6,8,13H2,1-3H3.
What are the key properties of [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine?
[1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine has a molecular weight of 196.34 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyclohexen-1-yl)-2,3-dimethylbutyl]hydrazine is sourced from PubChem (CID 106650486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).