C13H22F2N2 — CID 106650529
[cyclohexen-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine (PubChem CID 106650529) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is [cyclohexen-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine.
| Compound Name | [cyclohexen-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106650529 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | [cyclohexen-1-yl-(4,4-difluorocyclohexyl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H22F2N2/c14-13(15)8-6-11(7-9-13)12(17-16)10-4-2-1-3-5-10/h4,11-12,17H,1-3,5-9,16H2 |
| InChIKey | VJOOEMRFTKSSCS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|