C15H25NO — CID 106651408
7-(cyclohepten-1-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol (PubChem CID 106651408) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 7-(cyclohepten-1-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol.
| Compound Name | 7-(cyclohepten-1-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol |
|---|---|
| PubChem CID | 106651408 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 7-(cyclohepten-1-yl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ol |
| SMILES | OC1(C2=CCCCCC2)CCN2CCCC2C1 |
| InChI | InChI=1S/C15H25NO/c17-15(13-6-3-1-2-4-7-13)9-11-16-10-5-8-14(16)12-15/h6,14,17H,1-5,7-12H2 |
| InChIKey | UDXWKCZGCQGPLH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|