C14H24O2 — CID 106652247
1-(cyclohepten-1-yl)-2-ethoxy-2-methylbutan-1-one (PubChem CID 106652247) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-ethoxy-2-methylbutan-1-one.
| Compound Name | 1-(cyclohepten-1-yl)-2-ethoxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 106652247 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-ethoxy-2-methylbutan-1-one |
| SMILES | CCOC(C)(CC)C(=O)C1=CCCCCC1 |
| InChI | InChI=1S/C14H24O2/c1-4-14(3,16-5-2)13(15)12-10-8-6-7-9-11-12/h10H,4-9,11H2,1-3H3 |
| InChIKey | QYOGGPRROIRAMB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |