C15H26O2 — CID 106652249
1-(cyclohepten-1-yl)-2-ethoxy-2-ethylbutan-1-one (PubChem CID 106652249) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-ethoxy-2-ethylbutan-1-one.
| Compound Name | 1-(cyclohepten-1-yl)-2-ethoxy-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 106652249 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-ethoxy-2-ethylbutan-1-one |
| SMILES | CCOC(CC)(CC)C(=O)C1=CCCCCC1 |
| InChI | InChI=1S/C15H26O2/c1-4-15(5-2,17-6-3)14(16)13-11-9-7-8-10-12-13/h11H,4-10,12H2,1-3H3 |
| InChIKey | KKJCSYHWMRSQDH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |