C18H27N — CID 106652697
1-[(1E)-cycloocten-1-yl]-N-methyl-2-(3-methylphenyl)ethanamine (PubChem CID 106652697) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-[(1E)-cycloocten-1-yl]-N-methyl-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-[(1E)-cycloocten-1-yl]-N-methyl-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 106652697 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-[(1E)-cycloocten-1-yl]-N-methyl-2-(3-methylphenyl)ethanamine |
| SMILES | CNC(Cc1cccc(C)c1)/C1=C/CCCCCC1 |
| InChI | InChI=1S/C18H27N/c1-15-9-8-10-16(13-15)14-18(19-2)17-11-6-4-3-5-7-12-17/h8-11,13,18-19H,3-7,12,14H2,1-2H3/b17-11+ |
| InChIKey | HDVHAPURFPGBGC-GZTJUZNOSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|