About dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane
dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane (PubChem CID 10665273) has the molecular formula C21H31O2P
and a molecular weight of 346.45 g/mol. Its IUPAC name is dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane.
Molecular Properties
| Compound Name | dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane |
| PubChem CID | 10665273 |
| Molecular Formula | C21H31O2P |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane |
| SMILES | c1ccc(P(C2CCCCC2)C2CCCCC2)c(C2OCCO2)c1 |
| InChI | InChI=1S/C21H31O2P/c1-3-9-17(10-4-1)24(18-11-5-2-6-12-18)20-14-8-7-13-19(20)21-22-15-16-23-21/h7-8,13-14,17-18,21H,1-6,9-12,15-16H2 |
| InChIKey | DIFRDTMQEINUSG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane?
The IUPAC name of dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane (CID 10665273) is dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane.
What is the SMILES notation for dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane?
The canonical SMILES for dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane is c1ccc(P(C2CCCCC2)C2CCCCC2)c(C2OCCO2)c1.
What is the InChIKey of dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane?
The InChIKey is DIFRDTMQEINUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31O2P/c1-3-9-17(10-4-1)24(18-11-5-2-6-12-18)20-14-8-7-13-19(20)21-22-15-16-23-21/h7-8,13-14,17-18,21H,1-6,9-12,15-16H2.
What are the key properties of dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane?
dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane has a molecular weight of 346.45 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl-[2-(1,3-dioxolan-2-yl)phenyl]phosphane is sourced from PubChem (CID 10665273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).