About tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate
tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate (PubChem CID 10665344) has the molecular formula C20H29NO4
and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate |
| PubChem CID | 10665344 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C[C@H](O)[C@@H](C=C)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO4/c1-6-13-21(19(23)25-20(3,4)5)14-17(22)18(7-2)24-15-16-11-9-8-10-12-16/h6-12,17-18,22H,1-2,13-15H2,3-5H3/t17-,18+/m0/s1 |
| InChIKey | FAIGYTIDZNIRJG-ZWKOTPCHSA-N |
| XLogP | 3.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate?
The IUPAC name of tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate (CID 10665344) is tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate.
What is the SMILES notation for tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate?
The canonical SMILES for tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate is C=CCN(C[C@H](O)[C@@H](C=C)OCc1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate?
The InChIKey is FAIGYTIDZNIRJG-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H29NO4/c1-6-13-21(19(23)25-20(3,4)5)14-17(22)18(7-2)24-15-16-11-9-8-10-12-16/h6-12,17-18,22H,1-2,13-15H2,3-5H3/t17-,18+/m0/s1.
What are the key properties of tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate?
tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate has a molecular weight of 347.46 g/mol, XLogP of 3.54, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S,3R)-2-hydroxy-3-phenylmethoxypent-4-enyl]-N-prop-2-enylcarbamate is sourced from PubChem (CID 10665344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).