C15H20BrNS — CID 106653490
2-(2-bromophenyl)sulfanyl-1-(cyclohexen-1-yl)-N-methylethanamine (PubChem CID 106653490) has the molecular formula C15H20BrNS and a molecular weight of 326.30 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-1-(cyclohexen-1-yl)-N-methylethanamine.
| Compound Name | 2-(2-bromophenyl)sulfanyl-1-(cyclohexen-1-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 106653490 |
| Molecular Formula | C15H20BrNS |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-1-(cyclohexen-1-yl)-N-methylethanamine |
| SMILES | CNC(CSc1ccccc1Br)C1=CCCCC1 |
| InChI | InChI=1S/C15H20BrNS/c1-17-14(12-7-3-2-4-8-12)11-18-15-10-6-5-9-13(15)16/h5-7,9-10,14,17H,2-4,8,11H2,1H3 |
| InChIKey | IHTDLHKTKFAOLU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|