C20H20N4S — CID 10665419
8-(4-methylpiperazin-1-yl)-4-phenyl-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 10665419) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 8-(4-methylpiperazin-1-yl)-4-phenyl-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 8-(4-methylpiperazin-1-yl)-4-phenyl-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 10665419 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 8-(4-methylpiperazin-1-yl)-4-phenyl-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CN1CCN(c2nc3sc(-c4ccccc4)cc3n3cccc23)CC1 |
| InChI | InChI=1S/C20H20N4S/c1-22-10-12-23(13-11-22)19-16-8-5-9-24(16)17-14-18(25-20(17)21-19)15-6-3-2-4-7-15/h2-9,14H,10-13H2,1H3 |
| InChIKey | DRJDHULKURBTLQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |