C20H31NO2S — CID 10665496
(E,3R,4R)-6-cyclohexyl-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol (PubChem CID 10665496) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is (E,3R,4R)-6-cyclohexyl-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol.
| Compound Name | (E,3R,4R)-6-cyclohexyl-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 10665496 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (E,3R,4R)-6-cyclohexyl-2-methyl-4-(N-methyl-S-phenylsulfonimidoyl)hex-5-en-3-ol |
| SMILES | CN=S(=O)(c1ccccc1)[C@H](/C=C/C1CCCCC1)[C@H](O)C(C)C |
| InChI | InChI=1S/C20H31NO2S/c1-16(2)20(22)19(15-14-17-10-6-4-7-11-17)24(23,21-3)18-12-8-5-9-13-18/h5,8-9,12-17,19-20,22H,4,6-7,10-11H2,1-3H3/b15-14+/t19-,20-,24?/m1/s1 |
| InChIKey | BGZIYUFIWDGKTB-AIBMVEKHSA-N |
| XLogP | 4.67 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|