C22H39NO2 — CID 10665498
(1S,4aS,6R,7S)-7-ethyl-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1-methyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-6-ol (PubChem CID 10665498) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (1S,4aS,6R,7S)-7-ethyl-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1-methyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-6-ol.
| Compound Name | (1S,4aS,6R,7S)-7-ethyl-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1-methyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 10665498 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (1S,4aS,6R,7S)-7-ethyl-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1-methyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-6-ol |
| SMILES | CC[C@H]1C=C2[C@@H](CCN(C(C)(C)[C@@H]3CC[C@@H](C)C[C@H]3O)[C@H]2C)C[C@H]1O |
| InChI | InChI=1S/C22H39NO2/c1-6-16-12-18-15(3)23(10-9-17(18)13-20(16)24)22(4,5)19-8-7-14(2)11-21(19)25/h12,14-17,19-21,24-25H,6-11,13H2,1-5H3/t14-,15+,16+,17+,19-,20-,21-/m1/s1 |
| InChIKey | WILAYUVVFWJCQH-WHCUZVCWSA-N |
| XLogP | 3.99 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|