C18H28N2 — CID 106656300
1-[(1E)-cycloocten-1-yl]-N-ethyl-3-pyridin-3-ylpropan-1-amine (PubChem CID 106656300) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-[(1E)-cycloocten-1-yl]-N-ethyl-3-pyridin-3-ylpropan-1-amine.
| Compound Name | 1-[(1E)-cycloocten-1-yl]-N-ethyl-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 106656300 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-[(1E)-cycloocten-1-yl]-N-ethyl-3-pyridin-3-ylpropan-1-amine |
| SMILES | CCNC(CCc1cccnc1)/C1=C/CCCCCC1 |
| InChI | InChI=1S/C18H28N2/c1-2-20-18(13-12-16-9-8-14-19-15-16)17-10-6-4-3-5-7-11-17/h8-10,14-15,18,20H,2-7,11-13H2,1H3/b17-10+ |
| InChIKey | VTWLRCAQRNHJMC-LICLKQGHSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|