C18H31N3 — CID 106657201
1-(cyclohepten-1-yl)-N-ethyl-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine (PubChem CID 106657201) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-N-ethyl-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-N-ethyl-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 106657201 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 1-(cyclohepten-1-yl)-N-ethyl-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-amine |
| SMILES | CCNC(CCc1c(C)nn(C)c1C)C1=CCCCCC1 |
| InChI | InChI=1S/C18H31N3/c1-5-19-18(16-10-8-6-7-9-11-16)13-12-17-14(2)20-21(4)15(17)3/h10,18-19H,5-9,11-13H2,1-4H3 |
| InChIKey | PRRLGZWNRMWXFI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|