About N-(3,4,5-triphenylpyrazol-4-yl)acetamide
N-(3,4,5-triphenylpyrazol-4-yl)acetamide (PubChem CID 10665770) has the molecular formula C23H19N3O
and a molecular weight of 353.43 g/mol. Its IUPAC name is N-(3,4,5-triphenylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,4,5-triphenylpyrazol-4-yl)acetamide |
| PubChem CID | 10665770 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-(3,4,5-triphenylpyrazol-4-yl)acetamide |
| SMILES | CC(=O)NC1(c2ccccc2)C(c2ccccc2)=NN=C1c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c1-17(27)24-23(20-15-9-4-10-16-20)21(18-11-5-2-6-12-18)25-26-22(23)19-13-7-3-8-14-19/h2-16H,1H3,(H,24,27) |
| InChIKey | BOXULRWRLGQKPN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4,5-triphenylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4,5-triphenylpyrazol-4-yl)acetamide?
The IUPAC name of N-(3,4,5-triphenylpyrazol-4-yl)acetamide (CID 10665770) is N-(3,4,5-triphenylpyrazol-4-yl)acetamide.
What is the SMILES notation for N-(3,4,5-triphenylpyrazol-4-yl)acetamide?
The canonical SMILES for N-(3,4,5-triphenylpyrazol-4-yl)acetamide is CC(=O)NC1(c2ccccc2)C(c2ccccc2)=NN=C1c1ccccc1.
What is the InChIKey of N-(3,4,5-triphenylpyrazol-4-yl)acetamide?
The InChIKey is BOXULRWRLGQKPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O/c1-17(27)24-23(20-15-9-4-10-16-20)21(18-11-5-2-6-12-18)25-26-22(23)19-13-7-3-8-14-19/h2-16H,1H3,(H,24,27).
What are the key properties of N-(3,4,5-triphenylpyrazol-4-yl)acetamide?
N-(3,4,5-triphenylpyrazol-4-yl)acetamide has a molecular weight of 353.43 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4,5-triphenylpyrazol-4-yl)acetamide is sourced from PubChem (CID 10665770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).