C12H14Cl3NO2 — CID 106658164
2,2-dimethyl-N-(2,4,6-trichlorophenyl)-1,3-dioxan-5-amine (PubChem CID 106658164) has the molecular formula C12H14Cl3NO2 and a molecular weight of 310.61 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2,4,6-trichlorophenyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(2,4,6-trichlorophenyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658164 |
| Molecular Formula | C12H14Cl3NO2 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2,2-dimethyl-N-(2,4,6-trichlorophenyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(Nc2c(Cl)cc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C12H14Cl3NO2/c1-12(2)17-5-8(6-18-12)16-11-9(14)3-7(13)4-10(11)15/h3-4,8,16H,5-6H2,1-2H3 |
| InChIKey | JTJJPENPZXEKOE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |