C16H20N2O2 — CID 106658465
2,2-dimethyl-N-(3-pyrrol-1-ylphenyl)-1,3-dioxan-5-amine (PubChem CID 106658465) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-pyrrol-1-ylphenyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(3-pyrrol-1-ylphenyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658465 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2,2-dimethyl-N-(3-pyrrol-1-ylphenyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(Nc2cccc(-n3cccc3)c2)CO1 |
| InChI | InChI=1S/C16H20N2O2/c1-16(2)19-11-14(12-20-16)17-13-6-5-7-15(10-13)18-8-3-4-9-18/h3-10,14,17H,11-12H2,1-2H3 |
| InChIKey | KLHBXRFMYPJUPP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |