About 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine
2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine (PubChem CID 106658628) has the molecular formula C16H25NO3
and a molecular weight of 279.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine |
| PubChem CID | 106658628 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine |
| SMILES | Cc1cc(OC(C)C)ccc1NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C16H25NO3/c1-11(2)20-14-6-7-15(12(3)8-14)17-13-9-18-16(4,5)19-10-13/h6-8,11,13,17H,9-10H2,1-5H3 |
| InChIKey | AINMKVHONSHBIA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine?
The IUPAC name of 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine (CID 106658628) is 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine.
What is the SMILES notation for 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine?
The canonical SMILES for 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine is Cc1cc(OC(C)C)ccc1NC1COC(C)(C)OC1.
What is the InChIKey of 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine?
The InChIKey is AINMKVHONSHBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-11(2)20-14-6-7-15(12(3)8-14)17-13-9-18-16(4,5)19-10-13/h6-8,11,13,17H,9-10H2,1-5H3.
What are the key properties of 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine?
2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine has a molecular weight of 279.38 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-(2-methyl-4-propan-2-yloxyphenyl)-1,3-dioxan-5-amine is sourced from PubChem (CID 106658628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).