C8H18N2O2 — CID 106658957
2-(2,2-dimethyl-1,3-dioxan-5-yl)-1,1-dimethylhydrazine (PubChem CID 106658957) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxan-5-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxan-5-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 106658957 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxan-5-yl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C8H18N2O2/c1-8(2)11-5-7(6-12-8)9-10(3)4/h7,9H,5-6H2,1-4H3 |
| InChIKey | ADFOURHOFOQEKI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|