About N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine
N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine (PubChem CID 106658958) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine.
Molecular Properties
| Compound Name | N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine |
| PubChem CID | 106658958 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine |
| SMILES | CC1(C)OCC(NN2CCCCC2)CO1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2)14-8-10(9-15-11)12-13-6-4-3-5-7-13/h10,12H,3-9H2,1-2H3 |
| InChIKey | OBAKKYLDGAHCIV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine?
The IUPAC name of N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine (CID 106658958) is N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine.
What is the SMILES notation for N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine?
The canonical SMILES for N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine is CC1(C)OCC(NN2CCCCC2)CO1.
What is the InChIKey of N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine?
The InChIKey is OBAKKYLDGAHCIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-11(2)14-8-10(9-15-11)12-13-6-4-3-5-7-13/h10,12H,3-9H2,1-2H3.
What are the key properties of N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine?
N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine has a molecular weight of 214.31 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethyl-1,3-dioxan-5-yl)piperidin-1-amine is sourced from PubChem (CID 106658958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).