About 1-N-hexadecylhexane-1,2,6-triamine
1-N-hexadecylhexane-1,2,6-triamine (PubChem CID 10665912) has the molecular formula C22H49N3
and a molecular weight of 355.66 g/mol. Its IUPAC name is 1-N-hexadecylhexane-1,2,6-triamine.
Molecular Properties
| Compound Name | 1-N-hexadecylhexane-1,2,6-triamine |
| PubChem CID | 10665912 |
| Molecular Formula | C22H49N3 |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 355.39 |
| IUPAC Name | 1-N-hexadecylhexane-1,2,6-triamine |
| SMILES | CCCCCCCCCCCCCCCCNCC(N)CCCCN |
| InChI | InChI=1S/C22H49N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20-25-21-22(24)18-15-16-19-23/h22,25H,2-21,23-24H2,1H3 |
| InChIKey | KMADGIPBKUIAFY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-hexadecylhexane-1,2,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-hexadecylhexane-1,2,6-triamine?
The IUPAC name of 1-N-hexadecylhexane-1,2,6-triamine (CID 10665912) is 1-N-hexadecylhexane-1,2,6-triamine.
What is the SMILES notation for 1-N-hexadecylhexane-1,2,6-triamine?
The canonical SMILES for 1-N-hexadecylhexane-1,2,6-triamine is CCCCCCCCCCCCCCCCNCC(N)CCCCN.
What is the InChIKey of 1-N-hexadecylhexane-1,2,6-triamine?
The InChIKey is KMADGIPBKUIAFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H49N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20-25-21-22(24)18-15-16-19-23/h22,25H,2-21,23-24H2,1H3.
What are the key properties of 1-N-hexadecylhexane-1,2,6-triamine?
1-N-hexadecylhexane-1,2,6-triamine has a molecular weight of 355.66 g/mol, XLogP of 5.51, 21 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-hexadecylhexane-1,2,6-triamine is sourced from PubChem (CID 10665912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).