C11H20N4O — CID 106659350
4-butyl-N-methyl-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 106659350) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-butyl-N-methyl-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-butyl-N-methyl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106659350 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-butyl-N-methyl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CCCCc1nc(NC)nc(OC(C)C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-5-6-7-9-13-10(12-4)15-11(14-9)16-8(2)3/h8H,5-7H2,1-4H3,(H,12,13,14,15) |
| InChIKey | DHODZMYUVRUEML-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |