C10H19N3O — CID 106659745
3-methyl-N-(5-methylhexan-2-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 106659745) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-methyl-N-(5-methylhexan-2-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-methyl-N-(5-methylhexan-2-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 106659745 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-methyl-N-(5-methylhexan-2-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | Cc1noc(NC(C)CCC(C)C)n1 |
| InChI | InChI=1S/C10H19N3O/c1-7(2)5-6-8(3)11-10-12-9(4)13-14-10/h7-8H,5-6H2,1-4H3,(H,11,12,13) |
| InChIKey | DRBGTXXRMPVPPI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |