C25H40O — CID 10665993
2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15,17-pentaenyl]oxirane (PubChem CID 10665993) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15,17-pentaenyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15,17-pentaenyl]oxirane |
|---|---|
| PubChem CID | 10665993 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E,15Z)-3,7,12-trimethyloctadeca-3,7,11,15,17-pentaenyl]oxirane |
| SMILES | C=C/C=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C25H40O/c1-7-8-9-10-14-21(2)15-11-12-16-22(3)17-13-18-23(4)19-20-24-25(5,6)26-24/h7-9,15-16,18,24H,1,10-14,17,19-20H2,2-6H3/b9-8-,21-15+,22-16+,23-18+ |
| InChIKey | ZLFZRFFZFFSSEP-MBBSHWBZSA-N |
| XLogP | 7.87 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|