C10H11N3O2 — CID 106659974
4-[[(3-methyl-1,2,4-oxadiazol-5-yl)amino]methyl]phenol (PubChem CID 106659974) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-[[(3-methyl-1,2,4-oxadiazol-5-yl)amino]methyl]phenol.
| Compound Name | 4-[[(3-methyl-1,2,4-oxadiazol-5-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 106659974 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-[[(3-methyl-1,2,4-oxadiazol-5-yl)amino]methyl]phenol |
| SMILES | Cc1noc(NCc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H11N3O2/c1-7-12-10(15-13-7)11-6-8-2-4-9(14)5-3-8/h2-5,14H,6H2,1H3,(H,11,12,13) |
| InChIKey | OYHPAIASYUYQGE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |