C15H24N2O — CID 106660246
N-(2,3-dimethylcyclohexyl)-5-methoxy-2-methylpyridin-4-amine (PubChem CID 106660246) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-5-methoxy-2-methylpyridin-4-amine.
| Compound Name | N-(2,3-dimethylcyclohexyl)-5-methoxy-2-methylpyridin-4-amine |
|---|---|
| PubChem CID | 106660246 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-5-methoxy-2-methylpyridin-4-amine |
| SMILES | COc1cnc(C)cc1NC1CCCC(C)C1C |
| InChI | InChI=1S/C15H24N2O/c1-10-6-5-7-13(12(10)3)17-14-8-11(2)16-9-15(14)18-4/h8-10,12-13H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | IDQFXHNFLKFGKS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |