About tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate
tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate (PubChem CID 10666041) has the molecular formula C21H27NO4
and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate |
| PubChem CID | 10666041 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate |
| SMILES | CC1=C(CCCCCNC(=O)OC(C)(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H27NO4/c1-14-15(19(24)17-12-8-7-11-16(17)18(14)23)10-6-5-9-13-22-20(25)26-21(2,3)4/h7-8,11-12H,5-6,9-10,13H2,1-4H3,(H,22,25) |
| InChIKey | PDEMRZMVJFKANU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate?
The IUPAC name of tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate (CID 10666041) is tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate.
What is the SMILES notation for tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate?
The canonical SMILES for tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate is CC1=C(CCCCCNC(=O)OC(C)(C)C)C(=O)c2ccccc2C1=O.
What is the InChIKey of tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate?
The InChIKey is PDEMRZMVJFKANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4/c1-14-15(19(24)17-12-8-7-11-16(17)18(14)23)10-6-5-9-13-22-20(25)26-21(2,3)4/h7-8,11-12H,5-6,9-10,13H2,1-4H3,(H,22,25).
What are the key properties of tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate?
tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate has a molecular weight of 357.45 g/mol, XLogP of 4.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-(3-methyl-1,4-dioxonaphthalen-2-yl)pentyl]carbamate is sourced from PubChem (CID 10666041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).