C14H14ClFN2O — CID 106660477
N-[(3-chloro-4-fluorophenyl)methyl]-5-methoxy-2-methylpyridin-4-amine (PubChem CID 106660477) has the molecular formula C14H14ClFN2O and a molecular weight of 280.73 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-5-methoxy-2-methylpyridin-4-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-5-methoxy-2-methylpyridin-4-amine |
|---|---|
| PubChem CID | 106660477 |
| Molecular Formula | C14H14ClFN2O |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-5-methoxy-2-methylpyridin-4-amine |
| SMILES | COc1cnc(C)cc1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H14ClFN2O/c1-9-5-13(14(19-2)8-17-9)18-7-10-3-4-12(16)11(15)6-10/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | AEYIIZINYMJSOI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |