C12H19N3O — CID 106660833
5-methoxy-N,2-dimethyl-N-pyrrolidin-3-ylpyridin-4-amine (PubChem CID 106660833) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-methoxy-N,2-dimethyl-N-pyrrolidin-3-ylpyridin-4-amine.
| Compound Name | 5-methoxy-N,2-dimethyl-N-pyrrolidin-3-ylpyridin-4-amine |
|---|---|
| PubChem CID | 106660833 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 5-methoxy-N,2-dimethyl-N-pyrrolidin-3-ylpyridin-4-amine |
| SMILES | COc1cnc(C)cc1N(C)C1CCNC1 |
| InChI | InChI=1S/C12H19N3O/c1-9-6-11(12(16-3)8-14-9)15(2)10-4-5-13-7-10/h6,8,10,13H,4-5,7H2,1-3H3 |
| InChIKey | KEKQKFAOXVMWIO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |