C18H34O5Si — CID 10666133
methyl (2E,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-(hydroxymethyl)-3,7-dimethylocta-2,7-dienoate (PubChem CID 10666133) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is methyl (2E,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-(hydroxymethyl)-3,7-dimethylocta-2,7-dienoate.
| Compound Name | methyl (2E,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-(hydroxymethyl)-3,7-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 10666133 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | methyl (2E,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-6-(hydroxymethyl)-3,7-dimethylocta-2,7-dienoate |
| SMILES | C=C(C)[C@](O)(CO)C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C(=O)OC |
| InChI | InChI=1S/C18H34O5Si/c1-13(2)18(21,12-19)11-15(14(3)10-16(20)22-7)23-24(8,9)17(4,5)6/h10,15,19,21H,1,11-12H2,2-9H3/b14-10+/t15-,18+/m0/s1 |
| InChIKey | OKRFJODGQGQBRU-MHZPLBOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|