C19H38O4Si — CID 10666139
(E)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-3-ol (PubChem CID 10666139) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (E)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-3-ol.
| Compound Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 10666139 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oct-1-en-3-ol |
| SMILES | CC1(C)OC[C@H](/C=C/C(O)CCCCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H38O4Si/c1-18(2,3)24(6,7)22-14-10-8-9-11-16(20)12-13-17-15-21-19(4,5)23-17/h12-13,16-17,20H,8-11,14-15H2,1-7H3/b13-12+/t16?,17-/m0/s1 |
| InChIKey | QYCWWOGGBFDOHG-MQOABIRXSA-N |
| XLogP | 4.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|