C15H32N2 — CID 106661540
N,N,2,2-tetramethyl-N'-(2,4,4-trimethylcyclopentyl)propane-1,3-diamine (PubChem CID 106661540) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-(2,4,4-trimethylcyclopentyl)propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-(2,4,4-trimethylcyclopentyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106661540 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-(2,4,4-trimethylcyclopentyl)propane-1,3-diamine |
| SMILES | CC1CC(C)(C)CC1NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C15H32N2/c1-12-8-14(2,3)9-13(12)16-10-15(4,5)11-17(6)7/h12-13,16H,8-11H2,1-7H3 |
| InChIKey | OMAPYSZARJYSBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |