C22H32O4 — CID 10666246
(2R,4Z)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-2,3,6,7-tetrahydrooxocin-8-one (PubChem CID 10666246) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2R,4Z)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-2,3,6,7-tetrahydrooxocin-8-one.
| Compound Name | (2R,4Z)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-2,3,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 10666246 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2R,4Z)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-2,3,6,7-tetrahydrooxocin-8-one |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C/[C@@H](O)[C@@H]1C[C@H]1[C@H]1C/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-6-8-11-17(23)14-15-20(24)18-16-19(18)21-12-9-7-10-13-22(25)26-21/h3-4,6-9,14-15,17-21,23-24H,2,5,10-13,16H2,1H3/b4-3-,8-6-,9-7-,15-14+/t17-,18+,19+,20+,21+/m0/s1 |
| InChIKey | FGQRGNDJJATRPA-IDJUKYHNSA-N |
| XLogP | 3.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|