C22H36N2O2 — CID 10666255
(2S,5S)-2-decyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one (PubChem CID 10666255) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is (2S,5S)-2-decyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one.
| Compound Name | (2S,5S)-2-decyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
|---|---|
| PubChem CID | 10666255 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (2S,5S)-2-decyl-5-(hydroxymethyl)-1-methyl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
| SMILES | CCCCCCCCCC[C@H]1C(=O)N[C@H](CO)Cc2ccccc2N1C |
| InChI | InChI=1S/C22H36N2O2/c1-3-4-5-6-7-8-9-10-15-21-22(26)23-19(17-25)16-18-13-11-12-14-20(18)24(21)2/h11-14,19,21,25H,3-10,15-17H2,1-2H3,(H,23,26)/t19-,21-/m0/s1 |
| InChIKey | UZOFJSPXOMWUFZ-FPOVZHCZSA-N |
| XLogP | 4.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|