C12H22F3N — CID 106662697
2,4,4-trimethyl-N-(4,4,4-trifluorobutyl)cyclopentan-1-amine (PubChem CID 106662697) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(4,4,4-trifluorobutyl)cyclopentan-1-amine.
| Compound Name | 2,4,4-trimethyl-N-(4,4,4-trifluorobutyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 106662697 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2,4,4-trimethyl-N-(4,4,4-trifluorobutyl)cyclopentan-1-amine |
| SMILES | CC1CC(C)(C)CC1NCCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-9-7-11(2,3)8-10(9)16-6-4-5-12(13,14)15/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | GSSWOUFSBYSSTG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|