C10H18F3NO — CID 106662712
2,4,4-trimethyl-N-(2,2,2-trifluoroethoxy)cyclopentan-1-amine (PubChem CID 106662712) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(2,2,2-trifluoroethoxy)cyclopentan-1-amine.
| Compound Name | 2,4,4-trimethyl-N-(2,2,2-trifluoroethoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 106662712 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2,4,4-trimethyl-N-(2,2,2-trifluoroethoxy)cyclopentan-1-amine |
| SMILES | CC1CC(C)(C)CC1NOCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-7-4-9(2,3)5-8(7)14-15-6-10(11,12)13/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | YQKLKVGXUVKSAB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|