About 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one
5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (PubChem CID 10666322) has the molecular formula C20H31N3OS
and a molecular weight of 361.56 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| PubChem CID | 10666322 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1N1CCN(CCCCN2CSC(C)(C)C2=O)CC1 |
| InChI | InChI=1S/C20H31N3OS/c1-17-8-4-5-9-18(17)22-14-12-21(13-15-22)10-6-7-11-23-16-25-20(2,3)19(23)24/h4-5,8-9H,6-7,10-16H2,1-3H3 |
| InChIKey | XTVSAOCUGHTFMT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The IUPAC name of 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (CID 10666322) is 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
What is the SMILES notation for 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The canonical SMILES for 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one is Cc1ccccc1N1CCN(CCCCN2CSC(C)(C)C2=O)CC1.
What is the InChIKey of 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
The InChIKey is XTVSAOCUGHTFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3OS/c1-17-8-4-5-9-18(17)22-14-12-21(13-15-22)10-6-7-11-23-16-25-20(2,3)19(23)24/h4-5,8-9H,6-7,10-16H2,1-3H3.
What are the key properties of 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one?
5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one has a molecular weight of 361.56 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one is sourced from PubChem (CID 10666322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).