C27H22O — CID 10666371
(4S,5R,12S)-heptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaen-4-ol (PubChem CID 10666371) has the molecular formula C27H22O and a molecular weight of 362.47 g/mol. Its IUPAC name is (4S,5R,12S)-heptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaen-4-ol.
| Compound Name | (4S,5R,12S)-heptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaen-4-ol |
|---|---|
| PubChem CID | 10666371 |
| Molecular Formula | C27H22O |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (4S,5R,12S)-heptacyclo[11.6.6.25,12.01,5.06,11.014,19.020,25]heptacosa-6,8,10,14,16,18,20,22,24,26-decaen-4-ol |
| SMILES | O[C@H]1CCC23c4ccccc4C(c4ccccc42)[C@@H]2C=C[C@]13c1ccccc12 |
| InChI | InChI=1S/C27H22O/c28-24-14-16-26-22-11-5-2-8-19(22)25(20-9-3-6-12-23(20)26)18-13-15-27(24,26)21-10-4-1-7-17(18)21/h1-13,15,18,24-25,28H,14,16H2/t18-,24+,25?,26?,27+/m1/s1 |
| InChIKey | AEBGKXYAJHGSLR-RFRRBZHFSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|