C17H28F3NO2Si — CID 10666425
3-ethoxy-4,4,4-trifluoro-N,N-dimethyl-1-phenyl-3-trimethylsilyloxybutan-2-amine (PubChem CID 10666425) has the molecular formula C17H28F3NO2Si and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-ethoxy-4,4,4-trifluoro-N,N-dimethyl-1-phenyl-3-trimethylsilyloxybutan-2-amine.
| Compound Name | 3-ethoxy-4,4,4-trifluoro-N,N-dimethyl-1-phenyl-3-trimethylsilyloxybutan-2-amine |
|---|---|
| PubChem CID | 10666425 |
| Molecular Formula | C17H28F3NO2Si |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-ethoxy-4,4,4-trifluoro-N,N-dimethyl-1-phenyl-3-trimethylsilyloxybutan-2-amine |
| SMILES | CCOC(O[Si](C)(C)C)(C(Cc1ccccc1)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C17H28F3NO2Si/c1-7-22-16(17(18,19)20,23-24(4,5)6)15(21(2)3)13-14-11-9-8-10-12-14/h8-12,15H,7,13H2,1-6H3 |
| InChIKey | ZAVJQVLUJDQLTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|