C8H14I2 — CID 10666442
(E,4S)-1,6-diiodo-2,4-dimethylhex-1-ene (PubChem CID 10666442) has the molecular formula C8H14I2 and a molecular weight of 364.01 g/mol. Its IUPAC name is (E,4S)-1,6-diiodo-2,4-dimethylhex-1-ene.
| Compound Name | (E,4S)-1,6-diiodo-2,4-dimethylhex-1-ene |
|---|---|
| PubChem CID | 10666442 |
| Molecular Formula | C8H14I2 |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | (E,4S)-1,6-diiodo-2,4-dimethylhex-1-ene |
| SMILES | C/C(=C\I)C[C@H](C)CCI |
| InChI | InChI=1S/C8H14I2/c1-7(3-4-9)5-8(2)6-10/h6-7H,3-5H2,1-2H3/b8-6+/t7-/m1/s1 |
| InChIKey | OXCUBJCQVXKTLJ-UQBZRGDZSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|