About tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+)
tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) (PubChem CID 10666447) has the molecular formula C16H27ClOSiZn
and a molecular weight of 364.32 g/mol. Its IUPAC name is tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+).
Molecular Properties
| Compound Name | tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) |
| PubChem CID | 10666447 |
| Molecular Formula | C16H27ClOSiZn |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) |
| SMILES | CC(C)(C)c1c[c-]ccc1O[Si](C)(C)C(C)(C)C.Cl[Zn+] |
| InChI | InChI=1S/C16H27OSi.ClH.Zn/c1-15(2,3)13-11-9-10-12-14(13)17-18(7,8)16(4,5)6;;/h10-12H,1-8H3;1H;/q-1;;+2/p-1 |
| InChIKey | AMLMQYIDYKVZMH-UHFFFAOYSA-M |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+)?
The IUPAC name of tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) (CID 10666447) is tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+).
What is the SMILES notation for tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+)?
The canonical SMILES for tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) is CC(C)(C)c1c[c-]ccc1O[Si](C)(C)C(C)(C)C.Cl[Zn+].
What is the InChIKey of tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+)?
The InChIKey is AMLMQYIDYKVZMH-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H27OSi.ClH.Zn/c1-15(2,3)13-11-9-10-12-14(13)17-18(7,8)16(4,5)6;;/h10-12H,1-8H3;1H;/q-1;;+2/p-1.
What are the key properties of tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+)?
tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) has a molecular weight of 364.32 g/mol, XLogP of 5.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;chlorozinc(1+) is sourced from PubChem (CID 10666447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).