C13H15FN2 — CID 106664570
11-fluoro-3,3,5-trimethyl-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 106664570) has the molecular formula C13H15FN2 and a molecular weight of 218.27 g/mol. Its IUPAC name is 11-fluoro-3,3,5-trimethyl-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-fluoro-3,3,5-trimethyl-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 106664570 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 11-fluoro-3,3,5-trimethyl-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | CC1CC(C)(C)c2c1nc1ccc(F)cn21 |
| InChI | InChI=1S/C13H15FN2/c1-8-6-13(2,3)12-11(8)15-10-5-4-9(14)7-16(10)12/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | OLQPCDZPQHOFSH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |