C15H12FN3O5S — CID 10666509
ethyl 2-[3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate (PubChem CID 10666509) has the molecular formula C15H12FN3O5S and a molecular weight of 365.34 g/mol. Its IUPAC name is ethyl 2-[3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 10666509 |
| Molecular Formula | C15H12FN3O5S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | ethyl 2-[3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)N(Cc2nc3ccc(F)cc3s2)C1=O |
| InChI | InChI=1S/C15H12FN3O5S/c1-2-24-12(20)7-19-14(22)13(21)18(15(19)23)6-11-17-9-4-3-8(16)5-10(9)25-11/h3-5H,2,6-7H2,1H3 |
| InChIKey | OYZHMTVFXVUGJK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|