C12H18FNO3 — CID 106666373
[3-fluoro-2-(3-methoxy-3-methylbutoxy)-4-pyridinyl]methanol (PubChem CID 106666373) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is [3-fluoro-2-(3-methoxy-3-methylbutoxy)-4-pyridinyl]methanol.
| Compound Name | [3-fluoro-2-(3-methoxy-3-methylbutoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 106666373 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | [3-fluoro-2-(3-methoxy-3-methylbutoxy)-4-pyridinyl]methanol |
| SMILES | COC(C)(C)CCOc1nccc(CO)c1F |
| InChI | InChI=1S/C12H18FNO3/c1-12(2,16-3)5-7-17-11-10(13)9(8-15)4-6-14-11/h4,6,15H,5,7-8H2,1-3H3 |
| InChIKey | HROMJNKRGAIVCB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |