C10H15IN2O3 — CID 106666431
5-iodo-4-(3-methoxy-3-methylbutoxy)-1H-pyrimidin-6-one (PubChem CID 106666431) has the molecular formula C10H15IN2O3 and a molecular weight of 338.15 g/mol. Its IUPAC name is 5-iodo-4-(3-methoxy-3-methylbutoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(3-methoxy-3-methylbutoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 106666431 |
| Molecular Formula | C10H15IN2O3 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-iodo-4-(3-methoxy-3-methylbutoxy)-1H-pyrimidin-6-one |
| SMILES | COC(C)(C)CCOc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H15IN2O3/c1-10(2,15-3)4-5-16-9-7(11)8(14)12-6-13-9/h6H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | NCHMYEYLYHWQFG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|