About magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide
magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide (PubChem CID 10666681) has the molecular formula C16H27BrMgOSi
and a molecular weight of 367.69 g/mol. Its IUPAC name is magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide.
Molecular Properties
| Compound Name | magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide |
| PubChem CID | 10666681 |
| Molecular Formula | C16H27BrMgOSi |
| Molecular Weight | 367.69 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide |
| SMILES | CC(C)(C)c1c[c-]ccc1O[Si](C)(C)C(C)(C)C.[Br-].[Mg+2] |
| InChI | InChI=1S/C16H27OSi.BrH.Mg/c1-15(2,3)13-11-9-10-12-14(13)17-18(7,8)16(4,5)6;;/h10-12H,1-8H3;1H;/q-1;;+2/p-1 |
| InChIKey | KTNDXJXTIOBICR-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide?
The IUPAC name of magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide (CID 10666681) is magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide.
What is the SMILES notation for magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide?
The canonical SMILES for magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide is CC(C)(C)c1c[c-]ccc1O[Si](C)(C)C(C)(C)C.[Br-].[Mg+2].
What is the InChIKey of magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide?
The InChIKey is KTNDXJXTIOBICR-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H27OSi.BrH.Mg/c1-15(2,3)13-11-9-10-12-14(13)17-18(7,8)16(4,5)6;;/h10-12H,1-8H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide?
magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide has a molecular weight of 367.69 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;tert-butyl-(2-tert-butylbenzene-4-id-1-yl)oxy-dimethylsilane;bromide is sourced from PubChem (CID 10666681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).