C16H31NO4 — CID 106666862
methyl 2-[2-(3-methoxy-3-methylbutoxy)ethyl]-1-(methylamino)cyclopentane-1-carboxylate (PubChem CID 106666862) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is methyl 2-[2-(3-methoxy-3-methylbutoxy)ethyl]-1-(methylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[2-(3-methoxy-3-methylbutoxy)ethyl]-1-(methylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 106666862 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | methyl 2-[2-(3-methoxy-3-methylbutoxy)ethyl]-1-(methylamino)cyclopentane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCCC1CCOCCC(C)(C)OC |
| InChI | InChI=1S/C16H31NO4/c1-15(2,20-5)10-12-21-11-8-13-7-6-9-16(13,17-3)14(18)19-4/h13,17H,6-12H2,1-5H3 |
| InChIKey | KFPSGTOQMXSEJM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|